C21H24N2O5S — CID 139004986
5-(4-methoxyphenyl)-5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]imidazolidine-2,4-dione (PubChem CID 139004986) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-methoxyphenyl)-5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139004986 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(C)NC(=O)N(CCCS(=O)(=O)c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15-6-4-7-18(14-15)29(26,27)13-5-12-23-19(24)21(2,22-20(23)25)16-8-10-17(28-3)11-9-16/h4,6-11,14H,5,12-13H2,1-3H3,(H,22,25) |
| InChIKey | FYZBXRIGDLEVKM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|