C19H21N3O4S — CID 139004992
5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 139004992) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139004992 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-methyl-3-[3-(3-methylphenyl)sulfonylpropyl]-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(S(=O)(=O)CCCN2C(=O)NC(C)(c3ccccn3)C2=O)c1 |
| InChI | InChI=1S/C19H21N3O4S/c1-14-7-5-8-15(13-14)27(25,26)12-6-11-22-17(23)19(2,21-18(22)24)16-9-3-4-10-20-16/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,21,24) |
| InChIKey | WBWNICQVZIRPAB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|