C18H19N3O2 — CID 95295538
(5S)-3-[(2,5-dimethylphenyl)methyl]-5-methyl-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 95295538) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (5S)-3-[(2,5-dimethylphenyl)methyl]-5-methyl-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2,5-dimethylphenyl)methyl]-5-methyl-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95295538 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (5S)-3-[(2,5-dimethylphenyl)methyl]-5-methyl-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(CN2C(=O)N[C@@](C)(c3ccccn3)C2=O)c1 |
| InChI | InChI=1S/C18H19N3O2/c1-12-7-8-13(2)14(10-12)11-21-16(22)18(3,20-17(21)23)15-6-4-5-9-19-15/h4-10H,11H2,1-3H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | DGWUOWCHESFAKB-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|