C17H14F3N3O2 — CID 52884048
(5S)-5-methyl-5-pyridin-2-yl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 52884048) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is (5S)-5-methyl-5-pyridin-2-yl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-pyridin-2-yl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52884048 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (5S)-5-methyl-5-pyridin-2-yl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccccn2)NC(=O)N(Cc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H14F3N3O2/c1-16(13-4-2-3-9-21-13)14(24)23(15(25)22-16)10-11-5-7-12(8-6-11)17(18,19)20/h2-9H,10H2,1H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | ILDYOUFFULCWAH-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|