C23H20N4O3 — CID 97021801
4-[[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]methyl]-N-phenylbenzamide (PubChem CID 97021801) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 97021801 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]methyl]-N-phenylbenzamide |
| SMILES | C[C@]1(c2ccccn2)NC(=O)N(Cc2ccc(C(=O)Nc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C23H20N4O3/c1-23(19-9-5-6-14-24-19)21(29)27(22(30)26-23)15-16-10-12-17(13-11-16)20(28)25-18-7-3-2-4-8-18/h2-14H,15H2,1H3,(H,25,28)(H,26,30)/t23-/m1/s1 |
| InChIKey | UHBQHZVPLGBMIH-HSZRJFAPSA-N |
| XLogP | 3.30 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|