C24H19N3O3 — CID 7897314
4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide (PubChem CID 7897314) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 7897314 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CN2C(=O)N/C(=C\c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O3/c28-22(25-20-9-5-2-6-10-20)19-13-11-18(12-14-19)16-27-23(29)21(26-24(27)30)15-17-7-3-1-4-8-17/h1-15H,16H2,(H,25,28)(H,26,30)/b21-15- |
| InChIKey | HMFVCTZLFYEDEB-QNGOZBTKSA-N |
| XLogP | 4.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|