About 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid
3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid (PubChem CID 82148086) has the molecular formula C12H13N3O4
and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid |
| PubChem CID | 82148086 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid |
| SMILES | CC1(c2ccccn2)NC(=O)N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C12H13N3O4/c1-12(8-4-2-3-6-13-8)10(18)15(11(19)14-12)7-5-9(16)17/h2-4,6H,5,7H2,1H3,(H,14,19)(H,16,17) |
| InChIKey | WRNLGOHUFLCPBP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid?
The IUPAC name of 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid (CID 82148086) is 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid?
The canonical SMILES for 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid is CC1(c2ccccn2)NC(=O)N(CCC(=O)O)C1=O.
What is the InChIKey of 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid?
The InChIKey is WRNLGOHUFLCPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4/c1-12(8-4-2-3-6-13-8)10(18)15(11(19)14-12)7-5-9(16)17/h2-4,6H,5,7H2,1H3,(H,14,19)(H,16,17).
What are the key properties of 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid?
3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid has a molecular weight of 263.25 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)propanoic acid is sourced from PubChem (CID 82148086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).