C11H13N3O4 — CID 82297734
3-[4-methyl-2,5-dioxo-4-(1H-pyrrol-3-yl)imidazolidin-1-yl]propanoic acid (PubChem CID 82297734) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 3-[4-methyl-2,5-dioxo-4-(1H-pyrrol-3-yl)imidazolidin-1-yl]propanoic acid.
| Compound Name | 3-[4-methyl-2,5-dioxo-4-(1H-pyrrol-3-yl)imidazolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 82297734 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-[4-methyl-2,5-dioxo-4-(1H-pyrrol-3-yl)imidazolidin-1-yl]propanoic acid |
| SMILES | CC1(c2cc[nH]c2)NC(=O)N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C11H13N3O4/c1-11(7-2-4-12-6-7)9(17)14(10(18)13-11)5-3-8(15)16/h2,4,6,12H,3,5H2,1H3,(H,13,18)(H,15,16) |
| InChIKey | NWYWATUMQKDXAJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|