C15H15F3N2O2 — CID 27247656
3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 27247656) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 27247656 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)11-5-3-10(4-6-11)9-20-12(21)14(19-13(20)22)7-1-2-8-14/h3-6H,1-2,7-9H2,(H,19,22) |
| InChIKey | YAIBXYGDPGIGEQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|