C23H28ClN3O4 — CID 42979345
5-(4-chlorophenyl)-5-ethyl-3-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 42979345) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-5-ethyl-3-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-5-ethyl-3-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42979345 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-(4-chlorophenyl)-5-ethyl-3-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2cc(C)n(CCCOC)c2C)C1=O |
| InChI | InChI=1S/C23H28ClN3O4/c1-5-23(17-7-9-18(24)10-8-17)21(29)27(22(30)25-23)14-20(28)19-13-15(2)26(16(19)3)11-6-12-31-4/h7-10,13H,5-6,11-12,14H2,1-4H3,(H,25,30) |
| InChIKey | QCWPDFVRWGYTSV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|