C20H22FN3O3 — CID 2086402
(5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 2086402) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2086402 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)c2cc(C)n(C)c2C)C1=O |
| InChI | InChI=1S/C20H22FN3O3/c1-5-20(14-6-8-15(21)9-7-14)18(26)24(19(27)22-20)11-17(25)16-10-12(2)23(4)13(16)3/h6-10H,5,11H2,1-4H3,(H,22,27)/t20-/m1/s1 |
| InChIKey | CARLYBQWLJCGEA-HXUWFJFHSA-N |
| XLogP | 2.82 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|