C19H20ClN3O3 — CID 30285921
(5S)-5-(4-chlorophenyl)-3-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]-5-ethylimidazolidine-2,4-dione (PubChem CID 30285921) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (5S)-5-(4-chlorophenyl)-3-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]-5-ethylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-chlorophenyl)-3-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30285921 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (5S)-5-(4-chlorophenyl)-3-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]-5-ethylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2cc(C)[nH]c2C)C1=O |
| InChI | InChI=1S/C19H20ClN3O3/c1-4-19(13-5-7-14(20)8-6-13)17(25)23(18(26)22-19)10-16(24)15-9-11(2)21-12(15)3/h5-9,21H,4,10H2,1-3H3,(H,22,26)/t19-/m0/s1 |
| InChIKey | GLYHCQMUSXKXCQ-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|