C19H17Cl3N2O3 — CID 18284754
5-(4-chlorophenyl)-3-[2-(2,6-dichlorophenoxy)ethyl]-5-ethylimidazolidine-2,4-dione (PubChem CID 18284754) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[2-(2,6-dichlorophenoxy)ethyl]-5-ethylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[2-(2,6-dichlorophenoxy)ethyl]-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18284754 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[2-(2,6-dichlorophenoxy)ethyl]-5-ethylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CCOc2c(Cl)cccc2Cl)C1=O |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-2-19(12-6-8-13(20)9-7-12)17(25)24(18(26)23-19)10-11-27-16-14(21)4-3-5-15(16)22/h3-9H,2,10-11H2,1H3,(H,23,26) |
| InChIKey | NLXLUSVSKUCHHN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|