C16H18Cl2N2O3 — CID 7610121
3-[2-(2,6-dichlorophenoxy)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7610121) has the molecular formula C16H18Cl2N2O3 and a molecular weight of 357.24 g/mol. Its IUPAC name is 3-[2-(2,6-dichlorophenoxy)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(2,6-dichlorophenoxy)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7610121 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-[2-(2,6-dichlorophenoxy)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O3/c17-11-5-4-6-12(18)13(11)23-10-9-20-14(21)16(19-15(20)22)7-2-1-3-8-16/h4-6H,1-3,7-10H2,(H,19,22) |
| InChIKey | RJLQRSADGIFOOK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|