C14H14ClFN2O2 — CID 4280918
3-[(2-chloro-6-fluorophenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 4280918) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 4280918 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H14ClFN2O2/c15-10-4-3-5-11(16)9(10)8-18-12(19)14(17-13(18)20)6-1-2-7-14/h3-5H,1-2,6-8H2,(H,17,20) |
| InChIKey | BCTGUKRCLFGHCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|