C14H15ClFN3O2 — CID 115984165
3-[(2-chloro-3-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 115984165) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 115984165 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCNC2)C(=O)N1Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C14H15ClFN3O2/c15-11-9(3-1-4-10(11)16)7-19-12(20)14(18-13(19)21)5-2-6-17-8-14/h1,3-4,17H,2,5-8H2,(H,18,21) |
| InChIKey | VAJADYMJYYNLSK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|