C15H17ClFN3O2 — CID 70748418
3-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 70748418) has the molecular formula C15H17ClFN3O2 and a molecular weight of 325.77 g/mol. Its IUPAC name is 3-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 70748418 |
| Molecular Formula | C15H17ClFN3O2 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(Cl)c(CN2C(=O)NC3(CCNCC3)C2=O)c1F |
| InChI | InChI=1S/C15H17ClFN3O2/c1-9-2-3-11(16)10(12(9)17)8-20-13(21)15(19-14(20)22)4-6-18-7-5-15/h2-3,18H,4-8H2,1H3,(H,19,22) |
| InChIKey | XKCSJXKSYKDGGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|