C20H33N3O4 — CID 143811885
3-[(3,5-dimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;ethane (PubChem CID 143811885) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;ethane.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;ethane |
|---|---|
| PubChem CID | 143811885 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;ethane |
| SMILES | CC.CC.COc1cc(CN2C(=O)NC3(CCNCC3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C16H21N3O4.2C2H6/c1-22-12-7-11(8-13(9-12)23-2)10-19-14(20)16(18-15(19)21)3-5-17-6-4-16;2*1-2/h7-9,17H,3-6,10H2,1-2H3,(H,18,21);2*1-2H3 |
| InChIKey | IEDNTLLIDLCSPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|