C15H16N4O2 — CID 62850026
3-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile (PubChem CID 62850026) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile.
| Compound Name | 3-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 62850026 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C(=O)NC3(CCNCC3)C2=O)c1 |
| InChI | InChI=1S/C15H16N4O2/c16-9-11-2-1-3-12(8-11)10-19-13(20)15(18-14(19)21)4-6-17-7-5-15/h1-3,8,17H,4-7,10H2,(H,18,21) |
| InChIKey | IOYRVXBWEBIRTA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|