C17H17N3O2 — CID 60619510
3-[(4,4-dicyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile (PubChem CID 60619510) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[(4,4-dicyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(4,4-dicyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 60619510 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-[(4,4-dicyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C(=O)NC(C3CC3)(C3CC3)C2=O)c1 |
| InChI | InChI=1S/C17H17N3O2/c18-9-11-2-1-3-12(8-11)10-20-15(21)17(13-4-5-13,14-6-7-14)19-16(20)22/h1-3,8,13-14H,4-7,10H2,(H,19,22) |
| InChIKey | DYCZQMRNXOFIHP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|