C23H24N2O3 — CID 60619542
5,5-dicyclopropyl-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 60619542) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dicyclopropyl-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60619542 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 5,5-dicyclopropyl-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(C2CC2)(C2CC2)C(=O)N1Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c26-21-23(18-9-10-18,19-11-12-19)24-22(27)25(21)14-17-7-4-8-20(13-17)28-15-16-5-2-1-3-6-16/h1-8,13,18-19H,9-12,14-15H2,(H,24,27) |
| InChIKey | QKFGRAXQSHXEMQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|