C21H22N2O4 — CID 60604194
1-(2-methylpropyl)-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4,5-trione (PubChem CID 60604194) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-methylpropyl)-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 60604194 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-(2-methylpropyl)-3-[(3-phenylmethoxyphenyl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CC(C)CN1C(=O)C(=O)N(Cc2cccc(OCc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C21H22N2O4/c1-15(2)12-22-19(24)20(25)23(21(22)26)13-17-9-6-10-18(11-17)27-14-16-7-4-3-5-8-16/h3-11,15H,12-14H2,1-2H3 |
| InChIKey | WFWYPTWRVPHTQT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|