C18H15ClN2O4 — CID 18079393
1-benzyl-3-[2-(3-chlorophenoxy)ethyl]imidazolidine-2,4,5-trione (PubChem CID 18079393) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 1-benzyl-3-[2-(3-chlorophenoxy)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-benzyl-3-[2-(3-chlorophenoxy)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 18079393 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-benzyl-3-[2-(3-chlorophenoxy)ethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(Cc2ccccc2)C(=O)N1CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-14-7-4-8-15(11-14)25-10-9-20-16(22)17(23)21(18(20)24)12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2 |
| InChIKey | JJFHFFKLRFSKEV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|