C12H13ClN2O3 — CID 146122496
3-[2-(3-chlorophenoxy)ethyl]-1,3-diazinane-2,4-dione (PubChem CID 146122496) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)ethyl]-1,3-diazinane-2,4-dione.
| Compound Name | 3-[2-(3-chlorophenoxy)ethyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 146122496 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)ethyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCNC(=O)N1CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O3/c13-9-2-1-3-10(8-9)18-7-6-15-11(16)4-5-14-12(15)17/h1-3,8H,4-7H2,(H,14,17) |
| InChIKey | JKCSLGWKKUHMKA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |