C11H12N2O3 — CID 143380588
1-(2-pyridin-3-yloxyethyl)pyrrolidine-2,5-dione (PubChem CID 143380588) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(2-pyridin-3-yloxyethyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2-pyridin-3-yloxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143380588 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(2-pyridin-3-yloxyethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCOc1cccnc1 |
| InChI | InChI=1S/C11H12N2O3/c14-10-3-4-11(15)13(10)6-7-16-9-2-1-5-12-8-9/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | ALLJXDIYCKKERH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|