C10H8N2O5 — CID 87409322
(2,5-dioxopyrrolidin-1-yl) pyridin-3-yl carbonate (PubChem CID 87409322) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) pyridin-3-yl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) pyridin-3-yl carbonate |
|---|---|
| PubChem CID | 87409322 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) pyridin-3-yl carbonate |
| SMILES | O=C(Oc1cccnc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H8N2O5/c13-8-3-4-9(14)12(8)17-10(15)16-7-2-1-5-11-6-7/h1-2,5-6H,3-4H2 |
| InChIKey | FHTCARZUCPMSJG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|