C11H12N2O2 — CID 117125989
pyridin-3-yl 1,2,3,6-tetrahydropyridine-4-carboxylate (PubChem CID 117125989) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is pyridin-3-yl 1,2,3,6-tetrahydropyridine-4-carboxylate.
| Compound Name | pyridin-3-yl 1,2,3,6-tetrahydropyridine-4-carboxylate |
|---|---|
| PubChem CID | 117125989 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | pyridin-3-yl 1,2,3,6-tetrahydropyridine-4-carboxylate |
| SMILES | O=C(Oc1cccnc1)C1=CCNCC1 |
| InChI | InChI=1S/C11H12N2O2/c14-11(9-3-6-12-7-4-9)15-10-2-1-5-13-8-10/h1-3,5,8,12H,4,6-7H2 |
| InChIKey | ONSSQQLNITYCQG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |