C10H6N2O5 — CID 117215056
3-pyridin-3-yloxycarbonyl-1,2-oxazole-5-carboxylic acid (PubChem CID 117215056) has the molecular formula C10H6N2O5 and a molecular weight of 234.17 g/mol. Its IUPAC name is 3-pyridin-3-yloxycarbonyl-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-pyridin-3-yloxycarbonyl-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215056 |
| Molecular Formula | C10H6N2O5 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 3-pyridin-3-yloxycarbonyl-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(Oc1cccnc1)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C10H6N2O5/c13-9(14)8-4-7(12-17-8)10(15)16-6-2-1-3-11-5-6/h1-5H,(H,13,14) |
| InChIKey | VPZLGGBYONNUNB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |