C10H6N2O4S — CID 117218877
5-pyridin-3-yloxycarbonyl-1,2-thiazole-4-carboxylic acid (PubChem CID 117218877) has the molecular formula C10H6N2O4S and a molecular weight of 250.24 g/mol. Its IUPAC name is 5-pyridin-3-yloxycarbonyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-pyridin-3-yloxycarbonyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117218877 |
| Molecular Formula | C10H6N2O4S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 5-pyridin-3-yloxycarbonyl-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnsc1C(=O)Oc1cccnc1 |
| InChI | InChI=1S/C10H6N2O4S/c13-9(14)7-5-12-17-8(7)10(15)16-6-2-1-3-11-4-6/h1-5H,(H,13,14) |
| InChIKey | ZJSOYWYLDWFWKX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |