About 4-pyridin-3-yloxybenzoic acid
4-pyridin-3-yloxybenzoic acid (PubChem CID 22261667) has the molecular formula C12H9NO3
and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-pyridin-3-yloxybenzoic acid.
Molecular Properties
| Compound Name | 4-pyridin-3-yloxybenzoic acid |
| PubChem CID | 22261667 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-pyridin-3-yloxybenzoic acid |
| SMILES | O=C(O)c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C12H9NO3/c14-12(15)9-3-5-10(6-4-9)16-11-2-1-7-13-8-11/h1-8H,(H,14,15) |
| InChIKey | JZHQITAPTQQMIF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-3-yloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yloxybenzoic acid?
The IUPAC name of 4-pyridin-3-yloxybenzoic acid (CID 22261667) is 4-pyridin-3-yloxybenzoic acid.
What is the SMILES notation for 4-pyridin-3-yloxybenzoic acid?
The canonical SMILES for 4-pyridin-3-yloxybenzoic acid is O=C(O)c1ccc(Oc2cccnc2)cc1.
What is the InChIKey of 4-pyridin-3-yloxybenzoic acid?
The InChIKey is JZHQITAPTQQMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c14-12(15)9-3-5-10(6-4-9)16-11-2-1-7-13-8-11/h1-8H,(H,14,15).
What are the key properties of 4-pyridin-3-yloxybenzoic acid?
4-pyridin-3-yloxybenzoic acid has a molecular weight of 215.21 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yloxybenzoic acid is sourced from PubChem (CID 22261667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).