About 4-(4-fluorophenoxy)benzoic acid;pyridine
4-(4-fluorophenoxy)benzoic acid;pyridine (PubChem CID 139933963) has the molecular formula C18H14FNO3
and a molecular weight of 311.31 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)benzoic acid;pyridine.
Molecular Properties
| Compound Name | 4-(4-fluorophenoxy)benzoic acid;pyridine |
| PubChem CID | 139933963 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-(4-fluorophenoxy)benzoic acid;pyridine |
| SMILES | O=C(O)c1ccc(Oc2ccc(F)cc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C13H9FO3.C5H5N/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16;1-2-4-6-5-3-1/h1-8H,(H,15,16);1-5H |
| InChIKey | CWVFRICPBIRCOK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluorophenoxy)benzoic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenoxy)benzoic acid;pyridine?
The IUPAC name of 4-(4-fluorophenoxy)benzoic acid;pyridine (CID 139933963) is 4-(4-fluorophenoxy)benzoic acid;pyridine.
What is the SMILES notation for 4-(4-fluorophenoxy)benzoic acid;pyridine?
The canonical SMILES for 4-(4-fluorophenoxy)benzoic acid;pyridine is O=C(O)c1ccc(Oc2ccc(F)cc2)cc1.c1ccncc1.
What is the InChIKey of 4-(4-fluorophenoxy)benzoic acid;pyridine?
The InChIKey is CWVFRICPBIRCOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FO3.C5H5N/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16;1-2-4-6-5-3-1/h1-8H,(H,15,16);1-5H.
What are the key properties of 4-(4-fluorophenoxy)benzoic acid;pyridine?
4-(4-fluorophenoxy)benzoic acid;pyridine has a molecular weight of 311.31 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenoxy)benzoic acid;pyridine is sourced from PubChem (CID 139933963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).