C11H7NO6 — CID 117218109
5-(3-hydroxyphenoxy)carbonyl-1,2-oxazole-3-carboxylic acid (PubChem CID 117218109) has the molecular formula C11H7NO6 and a molecular weight of 249.18 g/mol. Its IUPAC name is 5-(3-hydroxyphenoxy)carbonyl-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3-hydroxyphenoxy)carbonyl-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117218109 |
| Molecular Formula | C11H7NO6 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-(3-hydroxyphenoxy)carbonyl-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)Oc2cccc(O)c2)on1 |
| InChI | InChI=1S/C11H7NO6/c13-6-2-1-3-7(4-6)17-11(16)9-5-8(10(14)15)12-18-9/h1-5,13H,(H,14,15) |
| InChIKey | VZGHEISZVUKLOI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|