About (3-hydroxyphenyl) 2-oxoacetate
(3-hydroxyphenyl) 2-oxoacetate (PubChem CID 174444543) has the molecular formula C8H6O4
and a molecular weight of 166.13 g/mol. Its IUPAC name is (3-hydroxyphenyl) 2-oxoacetate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) 2-oxoacetate |
| PubChem CID | 174444543 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (3-hydroxyphenyl) 2-oxoacetate |
| SMILES | O=CC(=O)Oc1cccc(O)c1 |
| InChI | InChI=1S/C8H6O4/c9-5-8(11)12-7-3-1-2-6(10)4-7/h1-5,10H |
| InChIKey | UCWBGKDAZIIDAY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) 2-oxoacetate?
The IUPAC name of (3-hydroxyphenyl) 2-oxoacetate (CID 174444543) is (3-hydroxyphenyl) 2-oxoacetate.
What is the SMILES notation for (3-hydroxyphenyl) 2-oxoacetate?
The canonical SMILES for (3-hydroxyphenyl) 2-oxoacetate is O=CC(=O)Oc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl) 2-oxoacetate?
The InChIKey is UCWBGKDAZIIDAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4/c9-5-8(11)12-7-3-1-2-6(10)4-7/h1-5,10H.
What are the key properties of (3-hydroxyphenyl) 2-oxoacetate?
(3-hydroxyphenyl) 2-oxoacetate has a molecular weight of 166.13 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) 2-oxoacetate is sourced from PubChem (CID 174444543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).