About 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate
3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate (PubChem CID 160578050) has the molecular formula C30H24O6
and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate.
Molecular Properties
| Compound Name | 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate |
| PubChem CID | 160578050 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(-c2cccc(OC(=O)C=C)c2)c1.Oc1cccc(-c2cccc(O)c2)c1 |
| InChI | InChI=1S/C18H14O4.C12H10O2/c1-3-17(19)21-15-9-5-7-13(11-15)14-8-6-10-16(12-14)22-18(20)4-2;13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h3-12H,1-2H2;1-8,13-14H |
| InChIKey | RBKGIFJOHYTCCY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate?
The IUPAC name of 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate (CID 160578050) is 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate.
What is the SMILES notation for 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate?
The canonical SMILES for 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate is C=CC(=O)Oc1cccc(-c2cccc(OC(=O)C=C)c2)c1.Oc1cccc(-c2cccc(O)c2)c1.
What is the InChIKey of 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate?
The InChIKey is RBKGIFJOHYTCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4.C12H10O2/c1-3-17(19)21-15-9-5-7-13(11-15)14-8-6-10-16(12-14)22-18(20)4-2;13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h3-12H,1-2H2;1-8,13-14H.
What are the key properties of 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate?
3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate has a molecular weight of 480.52 g/mol, XLogP of 6.30, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxyphenyl)phenol;[3-(3-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate is sourced from PubChem (CID 160578050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).