C25H18N2O2 — CID 175448130
[3-(2,6-diphenylpyrimidin-4-yl)phenyl] prop-2-enoate (PubChem CID 175448130) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is [3-(2,6-diphenylpyrimidin-4-yl)phenyl] prop-2-enoate.
| Compound Name | [3-(2,6-diphenylpyrimidin-4-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 175448130 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [3-(2,6-diphenylpyrimidin-4-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H18N2O2/c1-2-24(28)29-21-15-9-14-20(16-21)23-17-22(18-10-5-3-6-11-18)26-25(27-23)19-12-7-4-8-13-19/h2-17H,1H2 |
| InChIKey | BIVBNAXOTWNTRZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|