C40H26N4O4 — CID 153305203
[4-(2,6-diphenylpyrimidine-4-carbonyl)oxyphenyl] 2,6-diphenylpyrimidine-4-carboxylate (PubChem CID 153305203) has the molecular formula C40H26N4O4 and a molecular weight of 626.67 g/mol. Its IUPAC name is [4-(2,6-diphenylpyrimidine-4-carbonyl)oxyphenyl] 2,6-diphenylpyrimidine-4-carboxylate.
| Compound Name | [4-(2,6-diphenylpyrimidine-4-carbonyl)oxyphenyl] 2,6-diphenylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 153305203 |
| Molecular Formula | C40H26N4O4 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [4-(2,6-diphenylpyrimidine-4-carbonyl)oxyphenyl] 2,6-diphenylpyrimidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(OC(=O)c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)c1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C40H26N4O4/c45-39(35-25-33(27-13-5-1-6-14-27)41-37(43-35)29-17-9-3-10-18-29)47-31-21-23-32(24-22-31)48-40(46)36-26-34(28-15-7-2-8-16-28)42-38(44-36)30-19-11-4-12-20-30/h1-26H |
| InChIKey | GGHJUROMHPKZIO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|