C13H9NO4 — CID 10633973
6-phenylpyridine-2,4-dicarboxylic acid (PubChem CID 10633973) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 6-phenylpyridine-2,4-dicarboxylic acid.
| Compound Name | 6-phenylpyridine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 10633973 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 6-phenylpyridine-2,4-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H9NO4/c15-12(16)9-6-10(8-4-2-1-3-5-8)14-11(7-9)13(17)18/h1-7H,(H,15,16)(H,17,18) |
| InChIKey | XDVOFDQRYWKCJH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |