6-phenylpyridine-2,4-dicarboxylic acid

C13H9NO4 — CID 10633973

IUPAC6-phenylpyridine-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)nc(-c2ccccc2)c1
InChIInChI=1S/C13H9NO4/c15-12(16)9-6-10(8-4-2-1-3-5-8)14-11(7-9)13(17)18/h1-7H,(H,15,16)(H,17,18)
InChIKeyXDVOFDQRYWKCJH-UHFFFAOYSA-N
MW243.22 g/mol
LogP2.14
Rot. Bonds3

About 6-phenylpyridine-2,4-dicarboxylic acid

6-phenylpyridine-2,4-dicarboxylic acid (PubChem CID 10633973) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 6-phenylpyridine-2,4-dicarboxylic acid.

Molecular Properties

Compound Name6-phenylpyridine-2,4-dicarboxylic acid
PubChem CID10633973
Molecular FormulaC13H9NO4
Molecular Weight243.22 g/mol
Exact Mass243.05
IUPAC Name6-phenylpyridine-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)nc(-c2ccccc2)c1
InChIInChI=1S/C13H9NO4/c15-12(16)9-6-10(8-4-2-1-3-5-8)14-11(7-9)13(17)18/h1-7H,(H,15,16)(H,17,18)
InChIKeyXDVOFDQRYWKCJH-UHFFFAOYSA-N
XLogP2.14
TPSA87.49 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 52.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-phenylpyridine-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-phenylpyridine-2,4-dicarboxylic acid?
The IUPAC name of 6-phenylpyridine-2,4-dicarboxylic acid (CID 10633973) is 6-phenylpyridine-2,4-dicarboxylic acid.
What is the SMILES notation for 6-phenylpyridine-2,4-dicarboxylic acid?
The canonical SMILES for 6-phenylpyridine-2,4-dicarboxylic acid is O=C(O)c1cc(C(=O)O)nc(-c2ccccc2)c1.
What is the InChIKey of 6-phenylpyridine-2,4-dicarboxylic acid?
The InChIKey is XDVOFDQRYWKCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO4/c15-12(16)9-6-10(8-4-2-1-3-5-8)14-11(7-9)13(17)18/h1-7H,(H,15,16)(H,17,18).
What are the key properties of 6-phenylpyridine-2,4-dicarboxylic acid?
6-phenylpyridine-2,4-dicarboxylic acid has a molecular weight of 243.22 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylpyridine-2,4-dicarboxylic acid is sourced from PubChem (CID 10633973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).