C25H19NO2 — CID 54333176
4-[4-(4-methylphenyl)-6-phenyl-2-pyridinyl]benzoic acid (PubChem CID 54333176) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)-6-phenyl-2-pyridinyl]benzoic acid.
| Compound Name | 4-[4-(4-methylphenyl)-6-phenyl-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 54333176 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[4-(4-methylphenyl)-6-phenyl-2-pyridinyl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C25H19NO2/c1-17-7-9-18(10-8-17)22-15-23(19-5-3-2-4-6-19)26-24(16-22)20-11-13-21(14-12-20)25(27)28/h2-16H,1H3,(H,27,28) |
| InChIKey | SZTJWMNRQWOGCK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |