C25H16N2O6 — CID 155051674
5-[4,6-bis(4-carboxyphenyl)-2-pyridinyl]pyridine-2-carboxylic acid (PubChem CID 155051674) has the molecular formula C25H16N2O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is 5-[4,6-bis(4-carboxyphenyl)-2-pyridinyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[4,6-bis(4-carboxyphenyl)-2-pyridinyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155051674 |
| Molecular Formula | C25H16N2O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 5-[4,6-bis(4-carboxyphenyl)-2-pyridinyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)nc(-c3ccc(C(=O)O)nc3)c2)cc1 |
| InChI | InChI=1S/C25H16N2O6/c28-23(29)16-5-1-14(2-6-16)19-11-21(15-3-7-17(8-4-15)24(30)31)27-22(12-19)18-9-10-20(25(32)33)26-13-18/h1-13H,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | ZLKIBUQLQWGUTD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |