C54H33N3O6 — CID 126638828
tris(4-isoquinolin-3-ylphenyl) benzene-1,3,5-tricarboxylate (PubChem CID 126638828) has the molecular formula C54H33N3O6 and a molecular weight of 819.87 g/mol. Its IUPAC name is tris(4-isoquinolin-3-ylphenyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(4-isoquinolin-3-ylphenyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 126638828 |
| Molecular Formula | C54H33N3O6 |
| Molecular Weight | 819.87 g/mol |
| Exact Mass | 819.24 |
| IUPAC Name | tris(4-isoquinolin-3-ylphenyl) benzene-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2cc3ccccc3cn2)cc1)c1cc(C(=O)Oc2ccc(-c3cc4ccccc4cn3)cc2)cc(C(=O)Oc2ccc(-c3cc4ccccc4cn3)cc2)c1 |
| InChI | InChI=1S/C54H33N3O6/c58-52(61-46-19-13-34(14-20-46)49-28-37-7-1-4-10-40(37)31-55-49)43-25-44(53(59)62-47-21-15-35(16-22-47)50-29-38-8-2-5-11-41(38)32-56-50)27-45(26-43)54(60)63-48-23-17-36(18-24-48)51-30-39-9-3-6-12-42(39)33-57-51/h1-33H |
| InChIKey | ILHGGMIMAFHWKL-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.87 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|