C47H53NO4 — CID 3094932
[4-[6-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]-2-pyridinyl]phenyl] 3,5-ditert-butylbenzoate (PubChem CID 3094932) has the molecular formula C47H53NO4 and a molecular weight of 695.94 g/mol. Its IUPAC name is [4-[6-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]-2-pyridinyl]phenyl] 3,5-ditert-butylbenzoate.
| Compound Name | [4-[6-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]-2-pyridinyl]phenyl] 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 3094932 |
| Molecular Formula | C47H53NO4 |
| Molecular Weight | 695.94 g/mol |
| Exact Mass | 695.40 |
| IUPAC Name | [4-[6-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]-2-pyridinyl]phenyl] 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccc(-c3cccc(-c4ccc(OC(=O)c5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc4)n3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H53NO4/c1-44(2,3)34-24-32(25-35(28-34)45(4,5)6)42(49)51-38-20-16-30(17-21-38)40-14-13-15-41(48-40)31-18-22-39(23-19-31)52-43(50)33-26-36(46(7,8)9)29-37(27-33)47(10,11)12/h13-29H,1-12H3 |
| InChIKey | UNYAZEKDMNSLAL-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.94 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|