C33H45N — CID 102450802
2,6-bis(3,5-ditert-butylphenyl)pyridine (PubChem CID 102450802) has the molecular formula C33H45N and a molecular weight of 455.73 g/mol. Its IUPAC name is 2,6-bis(3,5-ditert-butylphenyl)pyridine.
| Compound Name | 2,6-bis(3,5-ditert-butylphenyl)pyridine |
|---|---|
| PubChem CID | 102450802 |
| Molecular Formula | C33H45N |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | 2,6-bis(3,5-ditert-butylphenyl)pyridine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H45N/c1-30(2,3)24-16-22(17-25(20-24)31(4,5)6)28-14-13-15-29(34-28)23-18-26(32(7,8)9)21-27(19-23)33(10,11)12/h13-21H,1-12H3 |
| InChIKey | JFZOKHVSYJANRY-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |