C45H66BrN3 — CID 159710261
2-bromo-6-(3,5-ditert-butylphenyl)pyridine;2-butyl-6-(3,5-ditert-butylphenyl)pyridine;propan-1-amine (PubChem CID 159710261) has the molecular formula C45H66BrN3 and a molecular weight of 728.95 g/mol. Its IUPAC name is 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;2-butyl-6-(3,5-ditert-butylphenyl)pyridine;propan-1-amine.
| Compound Name | 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;2-butyl-6-(3,5-ditert-butylphenyl)pyridine;propan-1-amine |
|---|---|
| PubChem CID | 159710261 |
| Molecular Formula | C45H66BrN3 |
| Molecular Weight | 728.95 g/mol |
| Exact Mass | 727.44 |
| IUPAC Name | 2-bromo-6-(3,5-ditert-butylphenyl)pyridine;2-butyl-6-(3,5-ditert-butylphenyl)pyridine;propan-1-amine |
| SMILES | CC(C)(C)c1cc(-c2cccc(Br)n2)cc(C(C)(C)C)c1.CCCCc1cccc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1.CCCN |
| InChI | InChI=1S/C23H33N.C19H24BrN.C3H9N/c1-8-9-11-20-12-10-13-21(24-20)17-14-18(22(2,3)4)16-19(15-17)23(5,6)7;1-18(2,3)14-10-13(11-15(12-14)19(4,5)6)16-8-7-9-17(20)21-16;1-2-3-4/h10,12-16H,8-9,11H2,1-7H3;7-12H,1-6H3;2-4H2,1H3 |
| InChIKey | MYTBDZKEYDQJJL-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.95 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|