C60H75ClSi — CID 88962392
chloro-tris[3-(3,5-ditert-butylphenyl)phenyl]silane (PubChem CID 88962392) has the molecular formula C60H75ClSi and a molecular weight of 859.80 g/mol. Its IUPAC name is chloro-tris[3-(3,5-ditert-butylphenyl)phenyl]silane.
| Compound Name | chloro-tris[3-(3,5-ditert-butylphenyl)phenyl]silane |
|---|---|
| PubChem CID | 88962392 |
| Molecular Formula | C60H75ClSi |
| Molecular Weight | 859.80 g/mol |
| Exact Mass | 858.53 |
| IUPAC Name | chloro-tris[3-(3,5-ditert-butylphenyl)phenyl]silane |
| SMILES | CC(C)(C)c1cc(-c2cccc([Si](Cl)(c3cccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)c3cccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H75ClSi/c1-55(2,3)46-28-43(29-47(37-46)56(4,5)6)40-22-19-25-52(34-40)62(61,53-26-20-23-41(35-53)44-30-48(57(7,8)9)38-49(31-44)58(10,11)12)54-27-21-24-42(36-54)45-32-50(59(13,14)15)39-51(33-45)60(16,17)18/h19-39H,1-18H3 |
| InChIKey | BGLKVTIGWSLFDI-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.80 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|