C41H38ClN3 — CID 160958371
2-[3-chloro-5-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 160958371) has the molecular formula C41H38ClN3 and a molecular weight of 608.23 g/mol. Its IUPAC name is 2-[3-chloro-5-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-chloro-5-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 160958371 |
| Molecular Formula | C41H38ClN3 |
| Molecular Weight | 608.23 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-[3-chloro-5-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(Cl)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H38ClN3/c1-40(2,3)34-22-32(23-35(26-34)41(4,5)6)30-19-13-18-29(20-30)31-21-33(25-36(42)24-31)39-44-37(27-14-9-7-10-15-27)43-38(45-39)28-16-11-8-12-17-28/h7-26H,1-6H3 |
| InChIKey | SUSXGKRQWRSEQC-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.23 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |