C48H46N6 — CID 164834086
2-[(E)-but-2-en-2-yl]-4-[3-(3,5-ditert-butylphenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 164834086) has the molecular formula C48H46N6 and a molecular weight of 706.94 g/mol. Its IUPAC name is 2-[(E)-but-2-en-2-yl]-4-[3-(3,5-ditert-butylphenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(E)-but-2-en-2-yl]-4-[3-(3,5-ditert-butylphenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164834086 |
| Molecular Formula | C48H46N6 |
| Molecular Weight | 706.94 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | 2-[(E)-but-2-en-2-yl]-4-[3-(3,5-ditert-butylphenyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C(\C)c1nc(-c2ccccc2)nc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C48H46N6/c1-9-31(2)41-49-42(32-19-13-10-14-20-32)52-45(50-41)37-25-35(36-28-39(47(3,4)5)30-40(29-36)48(6,7)8)26-38(27-37)46-53-43(33-21-15-11-16-22-33)51-44(54-46)34-23-17-12-18-24-34/h9-30H,1-8H3/b31-9+ |
| InChIKey | AJMXQIWHICGPKQ-LODFRUGASA-N |
| XLogP | 12.08 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.94 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |