C51H67N3 — CID 157308201
2,4-bis(3,5-ditert-butylphenyl)-6-[3-(3,5-ditert-butylphenyl)phenyl]-1,3,5-triazine (PubChem CID 157308201) has the molecular formula C51H67N3 and a molecular weight of 722.12 g/mol. Its IUPAC name is 2,4-bis(3,5-ditert-butylphenyl)-6-[3-(3,5-ditert-butylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(3,5-ditert-butylphenyl)-6-[3-(3,5-ditert-butylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 157308201 |
| Molecular Formula | C51H67N3 |
| Molecular Weight | 722.12 g/mol |
| Exact Mass | 721.53 |
| IUPAC Name | 2,4-bis(3,5-ditert-butylphenyl)-6-[3-(3,5-ditert-butylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3nc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)nc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)n3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C51H67N3/c1-46(2,3)37-23-34(24-38(29-37)47(4,5)6)32-20-19-21-33(22-32)43-52-44(35-25-39(48(7,8)9)30-40(26-35)49(10,11)12)54-45(53-43)36-27-41(50(13,14)15)31-42(28-36)51(16,17)18/h19-31H,1-18H3 |
| InChIKey | PFVSDHNXUVJXDH-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.12 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |