C24H29N3 — CID 168805959
2,4-bis(3-tert-butylphenyl)-6-methyl-1,3,5-triazine (PubChem CID 168805959) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is 2,4-bis(3-tert-butylphenyl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-bis(3-tert-butylphenyl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168805959 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2,4-bis(3-tert-butylphenyl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2cccc(C(C)(C)C)c2)nc(-c2cccc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C24H29N3/c1-16-25-21(17-10-8-12-19(14-17)23(2,3)4)27-22(26-16)18-11-9-13-20(15-18)24(5,6)7/h8-15H,1-7H3 |
| InChIKey | UFFOYOJLFJOASE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |