C16H11F2N3 — CID 134472353
2,4-bis(3-fluorophenyl)-6-methyl-1,3,5-triazine (PubChem CID 134472353) has the molecular formula C16H11F2N3 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,4-bis(3-fluorophenyl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-bis(3-fluorophenyl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134472353 |
| Molecular Formula | C16H11F2N3 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2,4-bis(3-fluorophenyl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2cccc(F)c2)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C16H11F2N3/c1-10-19-15(11-4-2-6-13(17)8-11)21-16(20-10)12-5-3-7-14(18)9-12/h2-9H,1H3 |
| InChIKey | OTMLDRCTHPLJII-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |