C15H9Cl2FN2 — CID 114590868
4,8-dichloro-2-(3-fluorophenyl)-6-methylquinazoline (PubChem CID 114590868) has the molecular formula C15H9Cl2FN2 and a molecular weight of 307.16 g/mol. Its IUPAC name is 4,8-dichloro-2-(3-fluorophenyl)-6-methylquinazoline.
| Compound Name | 4,8-dichloro-2-(3-fluorophenyl)-6-methylquinazoline |
|---|---|
| PubChem CID | 114590868 |
| Molecular Formula | C15H9Cl2FN2 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4,8-dichloro-2-(3-fluorophenyl)-6-methylquinazoline |
| SMILES | Cc1cc(Cl)c2nc(-c3cccc(F)c3)nc(Cl)c2c1 |
| InChI | InChI=1S/C15H9Cl2FN2/c1-8-5-11-13(12(16)6-8)19-15(20-14(11)17)9-3-2-4-10(18)7-9/h2-7H,1H3 |
| InChIKey | XGYSDTODHKFIMS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |